C19H23N3O3 — CID 140734053
(3R)-3-cyclobutyl-2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]butanamide (PubChem CID 140734053) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (3R)-3-cyclobutyl-2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]butanamide.
| Compound Name | (3R)-3-cyclobutyl-2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]butanamide |
|---|---|
| PubChem CID | 140734053 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (3R)-3-cyclobutyl-2-[(3S)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]butanamide |
| SMILES | C[C@H](C1CCC1)C(C(N)=O)N1C(=O)N[C@]2(CCc3ccccc32)C1=O |
| InChI | InChI=1S/C19H23N3O3/c1-11(12-6-4-7-12)15(16(20)23)22-17(24)19(21-18(22)25)10-9-13-5-2-3-8-14(13)19/h2-3,5,8,11-12,15H,4,6-7,9-10H2,1H3,(H2,20,23)(H,21,25)/t11-,15?,19+/m1/s1 |
| InChIKey | DIONFIPFWWWQJV-GHFIFVTDSA-N |
| XLogP | 1.67 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|