C19H23N3O4 — CID 140733985
(3S)-3-cyclobutyl-2-[(1S)-1-hydroxy-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]butanamide (PubChem CID 140733985) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is (3S)-3-cyclobutyl-2-[(1S)-1-hydroxy-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]butanamide.
| Compound Name | (3S)-3-cyclobutyl-2-[(1S)-1-hydroxy-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]butanamide |
|---|---|
| PubChem CID | 140733985 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (3S)-3-cyclobutyl-2-[(1S)-1-hydroxy-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]butanamide |
| SMILES | C[C@@H](C1CCC1)C(C(N)=O)N1C(=O)NC2(C[C@H](O)c3ccccc32)C1=O |
| InChI | InChI=1S/C19H23N3O4/c1-10(11-5-4-6-11)15(16(20)24)22-17(25)19(21-18(22)26)9-14(23)12-7-2-3-8-13(12)19/h2-3,7-8,10-11,14-15,23H,4-6,9H2,1H3,(H2,20,24)(H,21,26)/t10-,14-,15?,19?/m0/s1 |
| InChIKey | VMCQHDSBIHOQKV-HMQUJUMKSA-N |
| XLogP | 1.16 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|