C16H14N4O2 — CID 118961751
3-[(5-methyl-3-phenyl-1H-pyrazol-4-yl)amino]pyridine-4-carboxylic acid (PubChem CID 118961751) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-[(5-methyl-3-phenyl-1H-pyrazol-4-yl)amino]pyridine-4-carboxylic acid.
| Compound Name | 3-[(5-methyl-3-phenyl-1H-pyrazol-4-yl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 118961751 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-[(5-methyl-3-phenyl-1H-pyrazol-4-yl)amino]pyridine-4-carboxylic acid |
| SMILES | Cc1[nH]nc(-c2ccccc2)c1Nc1cnccc1C(=O)O |
| InChI | InChI=1S/C16H14N4O2/c1-10-14(15(20-19-10)11-5-3-2-4-6-11)18-13-9-17-8-7-12(13)16(21)22/h2-9,18H,1H3,(H,19,20)(H,21,22) |
| InChIKey | DKNIJTYTHABQQY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |