C25H26O6 — CID 118964842
cyclobutyl 1-[[2,3-dihydroxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]methyl]cyclobutane-1-carboxylate (PubChem CID 118964842) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is cyclobutyl 1-[[2,3-dihydroxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]methyl]cyclobutane-1-carboxylate.
| Compound Name | cyclobutyl 1-[[2,3-dihydroxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]methyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 118964842 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | cyclobutyl 1-[[2,3-dihydroxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]methyl]cyclobutane-1-carboxylate |
| SMILES | O=C1CCc2c1cccc2-c1ccc(O)c(O)c1OCC1(C(=O)OC2CCC2)CCC1 |
| InChI | InChI=1S/C25H26O6/c26-20-10-8-17-16(6-2-7-18(17)20)19-9-11-21(27)22(28)23(19)30-14-25(12-3-13-25)24(29)31-15-4-1-5-15/h2,6-7,9,11,15,27-28H,1,3-5,8,10,12-14H2 |
| InChIKey | QXQIVNUWJWFWOZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|