C24H26O12 — CID 89424626
ethyl 1-[[6-(1-oxo-2,3-dihydroinden-4-yl)-2,3-bis(trihydroxymethoxy)phenoxy]methyl]cyclopropane-1-carboxylate (PubChem CID 89424626) has the molecular formula C24H26O12 and a molecular weight of 506.46 g/mol. Its IUPAC name is ethyl 1-[[6-(1-oxo-2,3-dihydroinden-4-yl)-2,3-bis(trihydroxymethoxy)phenoxy]methyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[[6-(1-oxo-2,3-dihydroinden-4-yl)-2,3-bis(trihydroxymethoxy)phenoxy]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 89424626 |
| Molecular Formula | C24H26O12 |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | ethyl 1-[[6-(1-oxo-2,3-dihydroinden-4-yl)-2,3-bis(trihydroxymethoxy)phenoxy]methyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(COc2c(-c3cccc4c3CCC4=O)ccc(OC(O)(O)O)c2OC(O)(O)O)CC1 |
| InChI | InChI=1S/C24H26O12/c1-2-33-21(26)22(10-11-22)12-34-19-16(13-4-3-5-15-14(13)6-8-17(15)25)7-9-18(35-23(27,28)29)20(19)36-24(30,31)32/h3-5,7,9,27-32H,2,6,8,10-12H2,1H3 |
| InChIKey | ZZZAKPHEQISIFS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|