C24H28O6 — CID 71279644
butyl 2-[2-ethoxy-3-methoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]acetate (PubChem CID 71279644) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is butyl 2-[2-ethoxy-3-methoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]acetate.
| Compound Name | butyl 2-[2-ethoxy-3-methoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 71279644 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | butyl 2-[2-ethoxy-3-methoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]acetate |
| SMILES | CCCCOC(=O)COc1c(-c2cccc3c2CCC3=O)ccc(OC)c1OCC |
| InChI | InChI=1S/C24H28O6/c1-4-6-14-29-22(26)15-30-23-19(11-13-21(27-3)24(23)28-5-2)16-8-7-9-18-17(16)10-12-20(18)25/h7-9,11,13H,4-6,10,12,14-15H2,1-3H3 |
| InChIKey | CQQXXIKTDIZDTQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|