C22H24O5 — CID 54578700
[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenyl] pentanoate (PubChem CID 54578700) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is [2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenyl] pentanoate.
| Compound Name | [2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenyl] pentanoate |
|---|---|
| PubChem CID | 54578700 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1c(-c2cccc3c2CCC3=O)ccc(OC)c1OC |
| InChI | InChI=1S/C22H24O5/c1-4-5-9-20(24)27-21-17(11-13-19(25-2)22(21)26-3)14-7-6-8-16-15(14)10-12-18(16)23/h6-8,11,13H,4-5,9-10,12H2,1-3H3 |
| InChIKey | WSTPDAZWESITGV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|