C24H26O5 — CID 89421061
[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenyl] 2-cyclopentylacetate (PubChem CID 89421061) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is [2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenyl] 2-cyclopentylacetate.
| Compound Name | [2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 89421061 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenyl] 2-cyclopentylacetate |
| SMILES | COc1ccc(-c2cccc3c2CCC3=O)c(OC(=O)CC2CCCC2)c1OC |
| InChI | InChI=1S/C24H26O5/c1-27-21-13-11-19(16-8-5-9-18-17(16)10-12-20(18)25)23(24(21)28-2)29-22(26)14-15-6-3-4-7-15/h5,8-9,11,13,15H,3-4,6-7,10,12,14H2,1-2H3 |
| InChIKey | SCMDLZCYIYKIJA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|