C26H30O6 — CID 67468808
2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenoxy]ethyl 2-cyclopentylacetate (PubChem CID 67468808) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenoxy]ethyl 2-cyclopentylacetate.
| Compound Name | 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenoxy]ethyl 2-cyclopentylacetate |
|---|---|
| PubChem CID | 67468808 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenoxy]ethyl 2-cyclopentylacetate |
| SMILES | COc1ccc(-c2ccc3c(c2)CCC3=O)c(OCCOC(=O)CC2CCCC2)c1OC |
| InChI | InChI=1S/C26H30O6/c1-29-23-12-10-21(19-7-9-20-18(16-19)8-11-22(20)27)25(26(23)30-2)32-14-13-31-24(28)15-17-5-3-4-6-17/h7,9-10,12,16-17H,3-6,8,11,13-15H2,1-2H3 |
| InChIKey | BEVKDAUOKFYJEX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|