C24H26O6 — CID 118964820
2-[3-hydroxy-2-methoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenoxy]ethyl cyclopentanecarboxylate (PubChem CID 118964820) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[3-hydroxy-2-methoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenoxy]ethyl cyclopentanecarboxylate.
| Compound Name | 2-[3-hydroxy-2-methoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenoxy]ethyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 118964820 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 2-[3-hydroxy-2-methoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenoxy]ethyl cyclopentanecarboxylate |
| SMILES | COc1c(O)ccc(-c2ccc3c(c2)CCC3=O)c1OCCOC(=O)C1CCCC1 |
| InChI | InChI=1S/C24H26O6/c1-28-23-21(26)11-9-19(17-6-8-18-16(14-17)7-10-20(18)25)22(23)29-12-13-30-24(27)15-4-2-3-5-15/h6,8-9,11,14-15,26H,2-5,7,10,12-13H2,1H3 |
| InChIKey | PRKKUJSNIWMQBF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|