C26H32O6 — CID 118965001
2-[6-(4-acetyl-3-ethylphenyl)-2-methoxy-3-methylphenoxy]ethyl oxane-4-carboxylate (PubChem CID 118965001) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-[6-(4-acetyl-3-ethylphenyl)-2-methoxy-3-methylphenoxy]ethyl oxane-4-carboxylate.
| Compound Name | 2-[6-(4-acetyl-3-ethylphenyl)-2-methoxy-3-methylphenoxy]ethyl oxane-4-carboxylate |
|---|---|
| PubChem CID | 118965001 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2-[6-(4-acetyl-3-ethylphenyl)-2-methoxy-3-methylphenoxy]ethyl oxane-4-carboxylate |
| SMILES | CCc1cc(-c2ccc(C)c(OC)c2OCCOC(=O)C2CCOCC2)ccc1C(C)=O |
| InChI | InChI=1S/C26H32O6/c1-5-19-16-21(7-9-22(19)18(3)27)23-8-6-17(2)24(29-4)25(23)31-14-15-32-26(28)20-10-12-30-13-11-20/h6-9,16,20H,5,10-15H2,1-4H3 |
| InChIKey | OIYVOLGCEZDGQD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|