C25H30O5 — CID 118964999
cyclopropylmethyl 2-[6-(4-acetyl-3-ethylphenyl)-2-ethoxy-3-methylphenoxy]acetate (PubChem CID 118964999) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is cyclopropylmethyl 2-[6-(4-acetyl-3-ethylphenyl)-2-ethoxy-3-methylphenoxy]acetate.
| Compound Name | cyclopropylmethyl 2-[6-(4-acetyl-3-ethylphenyl)-2-ethoxy-3-methylphenoxy]acetate |
|---|---|
| PubChem CID | 118964999 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | cyclopropylmethyl 2-[6-(4-acetyl-3-ethylphenyl)-2-ethoxy-3-methylphenoxy]acetate |
| SMILES | CCOc1c(C)ccc(-c2ccc(C(C)=O)c(CC)c2)c1OCC(=O)OCC1CC1 |
| InChI | InChI=1S/C25H30O5/c1-5-19-13-20(10-12-21(19)17(4)26)22-11-7-16(3)24(28-6-2)25(22)30-15-23(27)29-14-18-8-9-18/h7,10-13,18H,5-6,8-9,14-15H2,1-4H3 |
| InChIKey | JSCYBUUOBMSRAK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |