C22H23NO6 — CID 67463982
2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-4-yl)phenoxy]ethyl cyclopropanecarboxylate (PubChem CID 67463982) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-4-yl)phenoxy]ethyl cyclopropanecarboxylate.
| Compound Name | 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-4-yl)phenoxy]ethyl cyclopropanecarboxylate |
|---|---|
| PubChem CID | 67463982 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-4-yl)phenoxy]ethyl cyclopropanecarboxylate |
| SMILES | COc1ccc(-c2cccc3c2CNC3=O)c(OCCOC(=O)C2CC2)c1OC |
| InChI | InChI=1S/C22H23NO6/c1-26-18-9-8-15(14-4-3-5-16-17(14)12-23-21(16)24)19(20(18)27-2)28-10-11-29-22(25)13-6-7-13/h3-5,8-9,13H,6-7,10-12H2,1-2H3,(H,23,24) |
| InChIKey | PVCYIQCTQYUPLY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|