C24H27NO6 — CID 67467053
butyl 1-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-4-yl)phenoxy]cyclopropane-1-carboxylate (PubChem CID 67467053) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is butyl 1-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-4-yl)phenoxy]cyclopropane-1-carboxylate.
| Compound Name | butyl 1-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-4-yl)phenoxy]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 67467053 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | butyl 1-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-4-yl)phenoxy]cyclopropane-1-carboxylate |
| SMILES | CCCCOC(=O)C1(Oc2c(-c3cccc4c3CNC4=O)ccc(OC)c2OC)CC1 |
| InChI | InChI=1S/C24H27NO6/c1-4-5-13-30-23(27)24(11-12-24)31-20-16(9-10-19(28-2)21(20)29-3)15-7-6-8-17-18(15)14-25-22(17)26/h6-10H,4-5,11-14H2,1-3H3,(H,25,26) |
| InChIKey | YGFOSOXTGIJLAZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|