C20H21NO6 — CID 67462834
2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]ethyl acetate (PubChem CID 67462834) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]ethyl acetate.
| Compound Name | 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]ethyl acetate |
|---|---|
| PubChem CID | 67462834 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]ethyl acetate |
| SMILES | COc1ccc(-c2ccc3c(c2)CNC3=O)c(OCCOC(C)=O)c1OC |
| InChI | InChI=1S/C20H21NO6/c1-12(22)26-8-9-27-18-15(6-7-17(24-2)19(18)25-3)13-4-5-16-14(10-13)11-21-20(16)23/h4-7,10H,8-9,11H2,1-3H3,(H,21,23) |
| InChIKey | QLQYLVFPFUABHM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|