C25H29NO5 — CID 118964931
2-[2-methoxy-3-methyl-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]ethyl cyclohexanecarboxylate (PubChem CID 118964931) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is 2-[2-methoxy-3-methyl-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]ethyl cyclohexanecarboxylate.
| Compound Name | 2-[2-methoxy-3-methyl-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]ethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 118964931 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-[2-methoxy-3-methyl-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]ethyl cyclohexanecarboxylate |
| SMILES | COc1c(C)ccc(-c2ccc3c(c2)CNC3=O)c1OCCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C25H29NO5/c1-16-8-10-20(18-9-11-21-19(14-18)15-26-24(21)27)23(22(16)29-2)30-12-13-31-25(28)17-6-4-3-5-7-17/h8-11,14,17H,3-7,12-13,15H2,1-2H3,(H,26,27) |
| InChIKey | YONYYMFCZBAVBX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|