C24H26FNO6 — CID 67466736
3-fluoropropyl 1-[[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]methyl]cyclopropane-1-carboxylate (PubChem CID 67466736) has the molecular formula C24H26FNO6 and a molecular weight of 443.47 g/mol. Its IUPAC name is 3-fluoropropyl 1-[[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]methyl]cyclopropane-1-carboxylate.
| Compound Name | 3-fluoropropyl 1-[[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 67466736 |
| Molecular Formula | C24H26FNO6 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 3-fluoropropyl 1-[[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]methyl]cyclopropane-1-carboxylate |
| SMILES | COc1ccc(-c2ccc3c(c2)CNC3=O)c(OCC2(C(=O)OCCCF)CC2)c1OC |
| InChI | InChI=1S/C24H26FNO6/c1-29-19-7-6-17(15-4-5-18-16(12-15)13-26-22(18)27)20(21(19)30-2)32-14-24(8-9-24)23(28)31-11-3-10-25/h4-7,12H,3,8-11,13-14H2,1-2H3,(H,26,27) |
| InChIKey | FMMXDDSUROQGRN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|