C22H25NO6 — CID 71279464
2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]ethyl 2-methylpropanoate (PubChem CID 71279464) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]ethyl 2-methylpropanoate.
| Compound Name | 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 71279464 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]ethyl 2-methylpropanoate |
| SMILES | COc1ccc(-c2ccc3c(c2)CNC3=O)c(OCCOC(=O)C(C)C)c1OC |
| InChI | InChI=1S/C22H25NO6/c1-13(2)22(25)29-10-9-28-19-16(7-8-18(26-3)20(19)27-4)14-5-6-17-15(11-14)12-23-21(17)24/h5-8,11,13H,9-10,12H2,1-4H3,(H,23,24) |
| InChIKey | XIYXBMMMDDHFHY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|