C25H31NO6 — CID 123239475
7-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]-6,6-dimethylheptanoic acid (PubChem CID 123239475) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is 7-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]-6,6-dimethylheptanoic acid.
| Compound Name | 7-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]-6,6-dimethylheptanoic acid |
|---|---|
| PubChem CID | 123239475 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 7-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroisoindol-5-yl)phenoxy]-6,6-dimethylheptanoic acid |
| SMILES | COc1ccc(-c2ccc3c(c2)CNC3=O)c(OCC(C)(C)CCCCC(=O)O)c1OC |
| InChI | InChI=1S/C25H31NO6/c1-25(2,12-6-5-7-21(27)28)15-32-22-18(10-11-20(30-3)23(22)31-4)16-8-9-19-17(13-16)14-26-24(19)29/h8-11,13H,5-7,12,14-15H2,1-4H3,(H,26,29)(H,27,28) |
| InChIKey | VSTSBMSNRVUBPX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|