C19H18O5 — CID 89420952
[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenyl] acetate (PubChem CID 89420952) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is [2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenyl] acetate.
| Compound Name | [2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenyl] acetate |
|---|---|
| PubChem CID | 89420952 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenyl] acetate |
| SMILES | COc1ccc(-c2ccc3c(c2)CCC3=O)c(OC(C)=O)c1OC |
| InChI | InChI=1S/C19H18O5/c1-11(20)24-18-15(7-9-17(22-2)19(18)23-3)13-4-6-14-12(10-13)5-8-16(14)21/h4,6-7,9-10H,5,8H2,1-3H3 |
| InChIKey | FFQJBHSEWAPSLP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|