C25H30O6 — CID 67465504
butyl 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenoxy]-2-methylpropanoate (PubChem CID 67465504) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is butyl 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenoxy]-2-methylpropanoate.
| Compound Name | butyl 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 67465504 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | butyl 2-[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-5-yl)phenoxy]-2-methylpropanoate |
| SMILES | CCCCOC(=O)C(C)(C)Oc1c(-c2ccc3c(c2)CCC3=O)ccc(OC)c1OC |
| InChI | InChI=1S/C25H30O6/c1-6-7-14-30-24(27)25(2,3)31-22-19(11-13-21(28-4)23(22)29-5)17-8-10-18-16(15-17)9-12-20(18)26/h8,10-11,13,15H,6-7,9,12,14H2,1-5H3 |
| InChIKey | BEUVCZZTOUYDGX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|