C24H28O7 — CID 67467687
butyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]-2-methylpropanoate (PubChem CID 67467687) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is butyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]-2-methylpropanoate.
| Compound Name | butyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 67467687 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | butyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]-2-methylpropanoate |
| SMILES | CCCCOC(=O)C(C)(C)Oc1c(-c2cccc3c2COC3=O)ccc(OC)c1OC |
| InChI | InChI=1S/C24H28O7/c1-6-7-13-29-23(26)24(2,3)31-20-16(11-12-19(27-4)21(20)28-5)15-9-8-10-17-18(15)14-30-22(17)25/h8-12H,6-7,13-14H2,1-5H3 |
| InChIKey | JRAYHHAWPXXBFL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|