About [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate
[1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate (PubChem CID 71287940) has the molecular formula C23H24O7
and a molecular weight of 412.44 g/mol. Its IUPAC name is [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate.
Molecular Properties
| Compound Name | [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate |
| PubChem CID | 71287940 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate |
| SMILES | CCC(=O)OC1(COc2c(-c3cccc4c3COC4=O)ccc(OC)c2OC)CC1 |
| InChI | InChI=1S/C23H24O7/c1-4-19(24)30-23(10-11-23)13-29-20-15(8-9-18(26-2)21(20)27-3)14-6-5-7-16-17(14)12-28-22(16)25/h5-9H,4,10-13H2,1-3H3 |
| InChIKey | FEUZVQMOZOFFIP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate?
The IUPAC name of [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate (CID 71287940) is [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate.
What is the SMILES notation for [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate?
The canonical SMILES for [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate is CCC(=O)OC1(COc2c(-c3cccc4c3COC4=O)ccc(OC)c2OC)CC1.
What is the InChIKey of [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate?
The InChIKey is FEUZVQMOZOFFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O7/c1-4-19(24)30-23(10-11-23)13-29-20-15(8-9-18(26-2)21(20)27-3)14-6-5-7-16-17(14)12-28-22(16)25/h5-9H,4,10-13H2,1-3H3.
What are the key properties of [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate?
[1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate has a molecular weight of 412.44 g/mol, XLogP of 3.91, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]methyl]cyclopropyl] propanoate is sourced from PubChem (CID 71287940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).