C23H26O7 — CID 71279884
2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]ethyl 3-methylbutanoate (PubChem CID 71279884) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]ethyl 3-methylbutanoate.
| Compound Name | 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]ethyl 3-methylbutanoate |
|---|---|
| PubChem CID | 71279884 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenoxy]ethyl 3-methylbutanoate |
| SMILES | COc1ccc(-c2cccc3c2COC3=O)c(OCCOC(=O)CC(C)C)c1OC |
| InChI | InChI=1S/C23H26O7/c1-14(2)12-20(24)28-10-11-29-21-16(8-9-19(26-3)22(21)27-4)15-6-5-7-17-18(15)13-30-23(17)25/h5-9,14H,10-13H2,1-4H3 |
| InChIKey | MEETZPHZAIEDCL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|