C21H22O6 — CID 89420921
[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenyl] pentanoate (PubChem CID 89420921) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is [2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenyl] pentanoate.
| Compound Name | [2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenyl] pentanoate |
|---|---|
| PubChem CID | 89420921 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-4-yl)phenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1c(-c2cccc3c2COC3=O)ccc(OC)c1OC |
| InChI | InChI=1S/C21H22O6/c1-4-5-9-18(22)27-19-14(10-11-17(24-2)20(19)25-3)13-7-6-8-15-16(13)12-26-21(15)23/h6-8,10-11H,4-5,9,12H2,1-3H3 |
| InChIKey | LAQNICBYCIFBAI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|