C24H23NO6S — CID 123383523
N-[[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]methyl]benzenesulfonamide (PubChem CID 123383523) has the molecular formula C24H23NO6S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]methyl]benzenesulfonamide.
| Compound Name | N-[[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 123383523 |
| Molecular Formula | C24H23NO6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]methyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2cccc3c2CCC3=O)c(OCNS(=O)(=O)c2ccccc2)c1OC |
| InChI | InChI=1S/C24H23NO6S/c1-29-22-14-12-20(17-9-6-10-19-18(17)11-13-21(19)26)23(24(22)30-2)31-15-25-32(27,28)16-7-4-3-5-8-16/h3-10,12,14,25H,11,13,15H2,1-2H3 |
| InChIKey | IGAXAYNYCDSLFC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|