C23H19F2NO7S — CID 123379906
N-[[2-(difluoromethoxy)-3-methoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]benzenesulfonamide (PubChem CID 123379906) has the molecular formula C23H19F2NO7S and a molecular weight of 491.47 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-3-methoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]benzenesulfonamide.
| Compound Name | N-[[2-(difluoromethoxy)-3-methoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 123379906 |
| Molecular Formula | C23H19F2NO7S |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | N-[[2-(difluoromethoxy)-3-methoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]benzenesulfonamide |
| SMILES | COc1ccc(-c2ccc3c(c2)COC3=O)c(OCNS(=O)(=O)c2ccccc2)c1OC(F)F |
| InChI | InChI=1S/C23H19F2NO7S/c1-30-19-10-9-17(14-7-8-18-15(11-14)12-31-22(18)27)20(21(19)33-23(24)25)32-13-26-34(28,29)16-5-3-2-4-6-16/h2-11,23,26H,12-13H2,1H3 |
| InChIKey | MBFQCKVYVAIOGW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|