C23H21N2O6+ — CID 123845272
amino-[3-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]phenyl]-oxoazanium (PubChem CID 123845272) has the molecular formula C23H21N2O6+ and a molecular weight of 421.43 g/mol. Its IUPAC name is amino-[3-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]phenyl]-oxoazanium.
| Compound Name | amino-[3-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]phenyl]-oxoazanium |
|---|---|
| PubChem CID | 123845272 |
| Molecular Formula | C23H21N2O6+ |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | amino-[3-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]phenyl]-oxoazanium |
| SMILES | COc1ccc(-c2ccc3c(c2)COC3=O)c(OCc2cccc([N+](N)=O)c2)c1OC |
| InChI | InChI=1S/C23H21N2O6/c1-28-20-9-8-18(15-6-7-19-16(11-15)13-31-23(19)26)21(22(20)29-2)30-12-14-4-3-5-17(10-14)25(24)27/h3-11H,12-13H2,1-2H3,(H2,24,27)/q+1 |
| InChIKey | CWWBIOZSRBWVGJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|