C21H20O6 — CID 54578243
[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenyl] cyclobutanecarboxylate (PubChem CID 54578243) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is [2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenyl] cyclobutanecarboxylate.
| Compound Name | [2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenyl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 54578243 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenyl] cyclobutanecarboxylate |
| SMILES | COc1ccc(-c2ccc3c(c2)COC3=O)c(OC(=O)C2CCC2)c1OC |
| InChI | InChI=1S/C21H20O6/c1-24-17-9-8-15(13-6-7-16-14(10-13)11-26-21(16)23)18(19(17)25-2)27-20(22)12-4-3-5-12/h6-10,12H,3-5,11H2,1-2H3 |
| InChIKey | SXVDYFGPYULVTQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|