About cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate
cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate (PubChem CID 71279624) has the molecular formula C25H28O7
and a molecular weight of 440.49 g/mol. Its IUPAC name is cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate.
Molecular Properties
| Compound Name | cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate |
| PubChem CID | 71279624 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate |
| SMILES | COc1ccc(-c2ccc3c(c2)COC3=O)c(OC(C)(C)C(=O)OC2CCCC2)c1OC |
| InChI | InChI=1S/C25H28O7/c1-25(2,24(27)31-17-7-5-6-8-17)32-21-18(11-12-20(28-3)22(21)29-4)15-9-10-19-16(13-15)14-30-23(19)26/h9-13,17H,5-8,14H2,1-4H3 |
| InChIKey | UIVQOGDXLXIKIA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate?
The IUPAC name of cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate (CID 71279624) is cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate.
What is the SMILES notation for cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate?
The canonical SMILES for cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate is COc1ccc(-c2ccc3c(c2)COC3=O)c(OC(C)(C)C(=O)OC2CCCC2)c1OC.
What is the InChIKey of cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate?
The InChIKey is UIVQOGDXLXIKIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28O7/c1-25(2,24(27)31-17-7-5-6-8-17)32-21-18(11-12-20(28-3)22(21)29-4)15-9-10-19-16(13-15)14-30-23(19)26/h9-13,17H,5-8,14H2,1-4H3.
What are the key properties of cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate?
cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate has a molecular weight of 440.49 g/mol, XLogP of 4.68, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]-2-methylpropanoate is sourced from PubChem (CID 71279624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).