C25H30O9 — CID 89424606
propan-2-yl 3-[3-methoxy-6-(1-oxo-2,3-dihydroinden-4-yl)-2-(trihydroxymethoxy)phenoxy]-2,2-dimethylpropanoate (PubChem CID 89424606) has the molecular formula C25H30O9 and a molecular weight of 474.51 g/mol. Its IUPAC name is propan-2-yl 3-[3-methoxy-6-(1-oxo-2,3-dihydroinden-4-yl)-2-(trihydroxymethoxy)phenoxy]-2,2-dimethylpropanoate.
| Compound Name | propan-2-yl 3-[3-methoxy-6-(1-oxo-2,3-dihydroinden-4-yl)-2-(trihydroxymethoxy)phenoxy]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 89424606 |
| Molecular Formula | C25H30O9 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | propan-2-yl 3-[3-methoxy-6-(1-oxo-2,3-dihydroinden-4-yl)-2-(trihydroxymethoxy)phenoxy]-2,2-dimethylpropanoate |
| SMILES | COc1ccc(-c2cccc3c2CCC3=O)c(OCC(C)(C)C(=O)OC(C)C)c1OC(O)(O)O |
| InChI | InChI=1S/C25H30O9/c1-14(2)33-23(27)24(3,4)13-32-21-18(10-12-20(31-5)22(21)34-25(28,29)30)15-7-6-8-17-16(15)9-11-19(17)26/h6-8,10,12,14,28-30H,9,11,13H2,1-5H3 |
| InChIKey | UCEPKGJNXRQOAH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|