C14H14NO5- — CID 11896543
(1S,2R,3R,4R)-3-[(4-hydroxyphenyl)carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 11896543) has the molecular formula C14H14NO5- and a molecular weight of 276.27 g/mol. Its IUPAC name is (1S,2R,3R,4R)-3-[(4-hydroxyphenyl)carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (1S,2R,3R,4R)-3-[(4-hydroxyphenyl)carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11896543 |
| Molecular Formula | C14H14NO5- |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (1S,2R,3R,4R)-3-[(4-hydroxyphenyl)carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1[C@@H](C(=O)Nc2ccc(O)cc2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C14H15NO5/c16-8-3-1-7(2-4-8)15-13(17)11-9-5-6-10(20-9)12(11)14(18)19/h1-4,9-12,16H,5-6H2,(H,15,17)(H,18,19)/p-1/t9-,10+,11+,12+/m1/s1 |
| InChIKey | NDSSZJRKPDTQGR-RHYQMDGZSA-M |
| XLogP | -0.13 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|