C18H19NO — CID 118966802
1,5-dimethyl-6-phenylmethoxy-3,4-dihydroisoquinoline (PubChem CID 118966802) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 1,5-dimethyl-6-phenylmethoxy-3,4-dihydroisoquinoline.
| Compound Name | 1,5-dimethyl-6-phenylmethoxy-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 118966802 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1,5-dimethyl-6-phenylmethoxy-3,4-dihydroisoquinoline |
| SMILES | CC1=NCCc2c1ccc(OCc1ccccc1)c2C |
| InChI | InChI=1S/C18H19NO/c1-13-16-10-11-19-14(2)17(16)8-9-18(13)20-12-15-6-4-3-5-7-15/h3-9H,10-12H2,1-2H3 |
| InChIKey | GIOGDOSFQKDMKU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |