C21H17ClFN3O2 — CID 118967097
[1-[(2-chlorophenyl)methyl]-3-(2-fluoropyrimidin-5-yl)-5-methoxyindol-2-yl]methanol (PubChem CID 118967097) has the molecular formula C21H17ClFN3O2 and a molecular weight of 397.84 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methyl]-3-(2-fluoropyrimidin-5-yl)-5-methoxyindol-2-yl]methanol.
| Compound Name | [1-[(2-chlorophenyl)methyl]-3-(2-fluoropyrimidin-5-yl)-5-methoxyindol-2-yl]methanol |
|---|---|
| PubChem CID | 118967097 |
| Molecular Formula | C21H17ClFN3O2 |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [1-[(2-chlorophenyl)methyl]-3-(2-fluoropyrimidin-5-yl)-5-methoxyindol-2-yl]methanol |
| SMILES | COc1ccc2c(c1)c(-c1cnc(F)nc1)c(CO)n2Cc1ccccc1Cl |
| InChI | InChI=1S/C21H17ClFN3O2/c1-28-15-6-7-18-16(8-15)20(14-9-24-21(23)25-10-14)19(12-27)26(18)11-13-4-2-3-5-17(13)22/h2-10,27H,11-12H2,1H3 |
| InChIKey | POCUZYBDMNQNPC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |