C23H17ClF3NO — CID 140928472
[1-[(2-chlorophenyl)methyl]-3-phenyl-5-(trifluoromethyl)indol-2-yl]methanol (PubChem CID 140928472) has the molecular formula C23H17ClF3NO and a molecular weight of 415.84 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methyl]-3-phenyl-5-(trifluoromethyl)indol-2-yl]methanol.
| Compound Name | [1-[(2-chlorophenyl)methyl]-3-phenyl-5-(trifluoromethyl)indol-2-yl]methanol |
|---|---|
| PubChem CID | 140928472 |
| Molecular Formula | C23H17ClF3NO |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [1-[(2-chlorophenyl)methyl]-3-phenyl-5-(trifluoromethyl)indol-2-yl]methanol |
| SMILES | OCc1c(-c2ccccc2)c2cc(C(F)(F)F)ccc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C23H17ClF3NO/c24-19-9-5-4-8-16(19)13-28-20-11-10-17(23(25,26)27)12-18(20)22(21(28)14-29)15-6-2-1-3-7-15/h1-12,29H,13-14H2 |
| InChIKey | JYKZGLCARMLOPP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |