C19H16Cl2F3N3O2 — CID 118967533
N-[(1S)-1-[2,6-dichloro-7-(pyridin-2-ylmethoxy)-1,2-dihydroquinolin-3-yl]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 118967533) has the molecular formula C19H16Cl2F3N3O2 and a molecular weight of 446.26 g/mol. Its IUPAC name is N-[(1S)-1-[2,6-dichloro-7-(pyridin-2-ylmethoxy)-1,2-dihydroquinolin-3-yl]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S)-1-[2,6-dichloro-7-(pyridin-2-ylmethoxy)-1,2-dihydroquinolin-3-yl]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 118967533 |
| Molecular Formula | C19H16Cl2F3N3O2 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | N-[(1S)-1-[2,6-dichloro-7-(pyridin-2-ylmethoxy)-1,2-dihydroquinolin-3-yl]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@H](NC(=O)C(F)(F)F)C1=Cc2cc(Cl)c(OCc3ccccn3)cc2NC1Cl |
| InChI | InChI=1S/C19H16Cl2F3N3O2/c1-10(26-18(28)19(22,23)24)13-6-11-7-14(20)16(8-15(11)27-17(13)21)29-9-12-4-2-3-5-25-12/h2-8,10,17,27H,9H2,1H3,(H,26,28)/t10-,17?/m0/s1 |
| InChIKey | DEBTUIWOHUWOLI-YOZOHBORSA-N |
| XLogP | 4.75 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|