C21H23Cl2N3O2S — CID 154591443
N-[1-[2,6-dichloro-7-(pyridin-2-ylmethoxy)quinolin-3-yl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 154591443) has the molecular formula C21H23Cl2N3O2S and a molecular weight of 452.41 g/mol. Its IUPAC name is N-[1-[2,6-dichloro-7-(pyridin-2-ylmethoxy)quinolin-3-yl]ethyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-[2,6-dichloro-7-(pyridin-2-ylmethoxy)quinolin-3-yl]ethyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 154591443 |
| Molecular Formula | C21H23Cl2N3O2S |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | N-[1-[2,6-dichloro-7-(pyridin-2-ylmethoxy)quinolin-3-yl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(NS(=O)C(C)(C)C)c1cc2cc(Cl)c(OCc3ccccn3)cc2nc1Cl |
| InChI | InChI=1S/C21H23Cl2N3O2S/c1-13(26-29(27)21(2,3)4)16-9-14-10-17(22)19(11-18(14)25-20(16)23)28-12-15-7-5-6-8-24-15/h5-11,13,26H,12H2,1-4H3 |
| InChIKey | ARIJVXNQTWXDNM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|