C18H15N5O2 — CID 118970275
methyl 3-[[1-(2-cyanophenyl)-3-methylpyrazol-4-yl]amino]pyridine-4-carboxylate (PubChem CID 118970275) has the molecular formula C18H15N5O2 and a molecular weight of 333.35 g/mol. Its IUPAC name is methyl 3-[[1-(2-cyanophenyl)-3-methylpyrazol-4-yl]amino]pyridine-4-carboxylate.
| Compound Name | methyl 3-[[1-(2-cyanophenyl)-3-methylpyrazol-4-yl]amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 118970275 |
| Molecular Formula | C18H15N5O2 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | methyl 3-[[1-(2-cyanophenyl)-3-methylpyrazol-4-yl]amino]pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccncc1Nc1cn(-c2ccccc2C#N)nc1C |
| InChI | InChI=1S/C18H15N5O2/c1-12-16(21-15-10-20-8-7-14(15)18(24)25-2)11-23(22-12)17-6-4-3-5-13(17)9-19/h3-8,10-11,21H,1-2H3 |
| InChIKey | IWUVNCRMUNQASK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |