C24H15N3O2 — CID 175705343
2-(3,4-dibenzoylpyrazol-1-yl)benzonitrile (PubChem CID 175705343) has the molecular formula C24H15N3O2 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-(3,4-dibenzoylpyrazol-1-yl)benzonitrile.
| Compound Name | 2-(3,4-dibenzoylpyrazol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 175705343 |
| Molecular Formula | C24H15N3O2 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-(3,4-dibenzoylpyrazol-1-yl)benzonitrile |
| SMILES | N#Cc1ccccc1-n1cc(C(=O)c2ccccc2)c(C(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C24H15N3O2/c25-15-19-13-7-8-14-21(19)27-16-20(23(28)17-9-3-1-4-10-17)22(26-27)24(29)18-11-5-2-6-12-18/h1-14,16H |
| InChIKey | PJSISRCLJPUSOS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |