C10H9F2N3 — CID 118970504
(1E,3Z)-6,6-difluoro-2-imidazol-4-yl-4-methylhexa-1,3,5-trien-1-amine (PubChem CID 118970504) has the molecular formula C10H9F2N3 and a molecular weight of 209.20 g/mol. Its IUPAC name is (1E,3Z)-6,6-difluoro-2-imidazol-4-yl-4-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z)-6,6-difluoro-2-imidazol-4-yl-4-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 118970504 |
| Molecular Formula | C10H9F2N3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | (1E,3Z)-6,6-difluoro-2-imidazol-4-yl-4-methylhexa-1,3,5-trien-1-amine |
| SMILES | C/C(C=C(F)F)=C/C(=C\N)C1=CN=C=N1 |
| InChI | InChI=1S/C10H9F2N3/c1-7(3-10(11)12)2-8(4-13)9-5-14-6-15-9/h2-5H,13H2,1H3/b7-2-,8-4+ |
| InChIKey | SBYQAUJHBVQZRH-GQOUTJHLSA-N |
| XLogP | 2.58 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|