C10H15F3N2 — CID 146203764
N'-[(3Z,5E)-2-methyl-5-(trifluoromethyl)hepta-3,5-dien-3-yl]methanimidamide (PubChem CID 146203764) has the molecular formula C10H15F3N2 and a molecular weight of 220.24 g/mol. Its IUPAC name is N'-[(3Z,5E)-2-methyl-5-(trifluoromethyl)hepta-3,5-dien-3-yl]methanimidamide.
| Compound Name | N'-[(3Z,5E)-2-methyl-5-(trifluoromethyl)hepta-3,5-dien-3-yl]methanimidamide |
|---|---|
| PubChem CID | 146203764 |
| Molecular Formula | C10H15F3N2 |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N'-[(3Z,5E)-2-methyl-5-(trifluoromethyl)hepta-3,5-dien-3-yl]methanimidamide |
| SMILES | C/C=C(\C=C(/N=C/N)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H15F3N2/c1-4-8(10(11,12)13)5-9(7(2)3)15-6-14/h4-7H,1-3H3,(H2,14,15)/b8-4+,9-5- |
| InChIKey | LXZJENMGWUSXQH-HXGSSHHBSA-N |
| XLogP | 3.02 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|