C12H15F3N2 — CID 143579831
N'-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-2,2,2-trifluoro-N-methylideneethanimidamide (PubChem CID 143579831) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is N'-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-2,2,2-trifluoro-N-methylideneethanimidamide.
| Compound Name | N'-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-2,2,2-trifluoro-N-methylideneethanimidamide |
|---|---|
| PubChem CID | 143579831 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N'-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-2,2,2-trifluoro-N-methylideneethanimidamide |
| SMILES | C=N/C(=N\C(=C\C=C(C)C)C(=C)C)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2/c1-8(2)6-7-10(9(3)4)17-11(16-5)12(13,14)15/h6-7H,3,5H2,1-2,4H3/b10-7+,17-11- |
| InChIKey | TTYWCDCKAHJECP-RMTJHLMQSA-N |
| XLogP | 4.07 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|