C11H16N2 — CID 143195803
N'-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-N-methylidenemethanimidamide (PubChem CID 143195803) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N'-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-N-methylidenemethanimidamide.
| Compound Name | N'-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-N-methylidenemethanimidamide |
|---|---|
| PubChem CID | 143195803 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N'-[(3E)-2,6-dimethylhepta-1,3,5-trien-3-yl]-N-methylidenemethanimidamide |
| SMILES | C=N/C=N\C(=C\C=C(C)C)C(=C)C |
| InChI | InChI=1S/C11H16N2/c1-9(2)6-7-11(10(3)4)13-8-12-5/h6-8H,3,5H2,1-2,4H3/b11-7+,13-8+ |
| InChIKey | MAZSQEZLKJCMCK-ZHSLHGDYSA-N |
| XLogP | 3.14 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|