C10H15N — CID 123907280
N-(5,6-dimethylhepta-2,4,6-trien-2-yl)methanimine (PubChem CID 123907280) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is N-(5,6-dimethylhepta-2,4,6-trien-2-yl)methanimine.
| Compound Name | N-(5,6-dimethylhepta-2,4,6-trien-2-yl)methanimine |
|---|---|
| PubChem CID | 123907280 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-(5,6-dimethylhepta-2,4,6-trien-2-yl)methanimine |
| SMILES | C=NC(C)=CC=C(C)C(=C)C |
| InChI | InChI=1S/C10H15N/c1-8(2)9(3)6-7-10(4)11-5/h6-7H,1,5H2,2-4H3 |
| InChIKey | CBGSGDUEKQZZAI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|