C7H11F3N2 — CID 154964899
N'-[(Z)-1,1,1-trifluoro-4-methylpent-2-en-2-yl]methanimidamide (PubChem CID 154964899) has the molecular formula C7H11F3N2 and a molecular weight of 180.17 g/mol. Its IUPAC name is N'-[(Z)-1,1,1-trifluoro-4-methylpent-2-en-2-yl]methanimidamide.
| Compound Name | N'-[(Z)-1,1,1-trifluoro-4-methylpent-2-en-2-yl]methanimidamide |
|---|---|
| PubChem CID | 154964899 |
| Molecular Formula | C7H11F3N2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | N'-[(Z)-1,1,1-trifluoro-4-methylpent-2-en-2-yl]methanimidamide |
| SMILES | CC(C)/C=C(\N=C\N)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2/c1-5(2)3-6(12-4-11)7(8,9)10/h3-5H,1-2H3,(H2,11,12)/b6-3- |
| InChIKey | RSBKGROCCHEFKQ-UTCJRWHESA-N |
| XLogP | 2.08 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|