C9H12F2N2 — CID 164558249
N'-[(3Z,5Z)-8,8-difluoroocta-1,3,5-trien-3-yl]methanimidamide (PubChem CID 164558249) has the molecular formula C9H12F2N2 and a molecular weight of 186.20 g/mol. Its IUPAC name is N'-[(3Z,5Z)-8,8-difluoroocta-1,3,5-trien-3-yl]methanimidamide.
| Compound Name | N'-[(3Z,5Z)-8,8-difluoroocta-1,3,5-trien-3-yl]methanimidamide |
|---|---|
| PubChem CID | 164558249 |
| Molecular Formula | C9H12F2N2 |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | N'-[(3Z,5Z)-8,8-difluoroocta-1,3,5-trien-3-yl]methanimidamide |
| SMILES | C=CC(=C/C=C\CC(F)F)/N=C/N |
| InChI | InChI=1S/C9H12F2N2/c1-2-8(13-7-12)5-3-4-6-9(10)11/h2-5,7,9H,1,6H2,(H2,12,13)/b4-3-,8-5- |
| InChIKey | DUDMCKCSDZNMDU-UBNNFMAXSA-N |
| XLogP | 2.25 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|