C11H18F2N2 — CID 144415055
N-[(3Z,5E)-8,8-difluoronona-3,5-dien-5-yl]-N'-methylmethanimidamide (PubChem CID 144415055) has the molecular formula C11H18F2N2 and a molecular weight of 216.27 g/mol. Its IUPAC name is N-[(3Z,5E)-8,8-difluoronona-3,5-dien-5-yl]-N'-methylmethanimidamide.
| Compound Name | N-[(3Z,5E)-8,8-difluoronona-3,5-dien-5-yl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 144415055 |
| Molecular Formula | C11H18F2N2 |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N-[(3Z,5E)-8,8-difluoronona-3,5-dien-5-yl]-N'-methylmethanimidamide |
| SMILES | CC/C=C\C(=C/CC(C)(F)F)\NC=NC |
| InChI | InChI=1S/C11H18F2N2/c1-4-5-6-10(15-9-14-3)7-8-11(2,12)13/h5-7,9H,4,8H2,1-3H3,(H,14,15)/b6-5-,10-7+ |
| InChIKey | ICBTYEUNCPSJTC-ZZWPSLBBSA-N |
| XLogP | 2.80 |
| TPSA | 24.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | 255 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|