C10H18N2 — CID 146356832
N'-methyl-N-[(2E,6E)-octa-2,6-dien-2-yl]methanimidamide (PubChem CID 146356832) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N'-methyl-N-[(2E,6E)-octa-2,6-dien-2-yl]methanimidamide.
| Compound Name | N'-methyl-N-[(2E,6E)-octa-2,6-dien-2-yl]methanimidamide |
|---|---|
| PubChem CID | 146356832 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N'-methyl-N-[(2E,6E)-octa-2,6-dien-2-yl]methanimidamide |
| SMILES | C/C=C/CC/C=C(\C)N/C=N/C |
| InChI | InChI=1S/C10H18N2/c1-4-5-6-7-8-10(2)12-9-11-3/h4-5,8-9H,6-7H2,1-3H3,(H,11,12)/b5-4+,10-8+ |
| InChIKey | ZBAJDGRGTUNWNL-SYOZQWSFSA-N |
| XLogP | 2.49 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|