C7H11N3 — CID 123202821
8-methyl-1,6-dihydro-1,3-diazocin-7-amine (PubChem CID 123202821) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 8-methyl-1,6-dihydro-1,3-diazocin-7-amine.
| Compound Name | 8-methyl-1,6-dihydro-1,3-diazocin-7-amine |
|---|---|
| PubChem CID | 123202821 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 8-methyl-1,6-dihydro-1,3-diazocin-7-amine |
| SMILES | CC1=C(N)CC=C/N=C\N1 |
| InChI | InChI=1S/C7H11N3/c1-6-7(8)3-2-4-9-5-10-6/h2,4-5H,3,8H2,1H3,(H,9,10) |
| InChIKey | AMXSOYVJKUGCKL-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |