C8H11F3N2O — CID 129253220
N'-[(3E)-hexa-3,5-dien-3-yl]-N-(trifluoromethoxy)methanimidamide (PubChem CID 129253220) has the molecular formula C8H11F3N2O and a molecular weight of 208.18 g/mol. Its IUPAC name is N'-[(3E)-hexa-3,5-dien-3-yl]-N-(trifluoromethoxy)methanimidamide.
| Compound Name | N'-[(3E)-hexa-3,5-dien-3-yl]-N-(trifluoromethoxy)methanimidamide |
|---|---|
| PubChem CID | 129253220 |
| Molecular Formula | C8H11F3N2O |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N'-[(3E)-hexa-3,5-dien-3-yl]-N-(trifluoromethoxy)methanimidamide |
| SMILES | C=C/C=C(CC)/N=C/NOC(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O/c1-3-5-7(4-2)12-6-13-14-8(9,10)11/h3,5-6H,1,4H2,2H3,(H,12,13)/b7-5+ |
| InChIKey | LNIKFGJKIFTBRY-FNORWQNLSA-N |
| XLogP | 2.54 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|